C27H23Cl3N4O4S2 — CID 19638432
methyl 4-(4-chlorophenyl)-2-[[2-[[5-[1-(2,5-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 19638432) has the molecular formula C27H23Cl3N4O4S2 and a molecular weight of 638.00 g/mol. Its IUPAC name is methyl 4-(4-chlorophenyl)-2-[[2-[[5-[1-(2,5-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-chlorophenyl)-2-[[2-[[5-[1-(2,5-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19638432 |
| Molecular Formula | C27H23Cl3N4O4S2 |
| Molecular Weight | 638.00 g/mol |
| Exact Mass | 636.02 |
| IUPAC Name | methyl 4-(4-chlorophenyl)-2-[[2-[[5-[1-(2,5-dichlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2scc(-c3ccc(Cl)cc3)c2C(=O)OC)nnc1C(C)Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C27H23Cl3N4O4S2/c1-4-11-34-24(15(2)38-21-12-18(29)9-10-20(21)30)32-33-27(34)40-14-22(35)31-25-23(26(36)37-3)19(13-39-25)16-5-7-17(28)8-6-16/h4-10,12-13,15H,1,11,14H2,2-3H3,(H,31,35) |
| InChIKey | BOEZKECGDCHSOA-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.00 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|