C27H25FN4O5S2 — CID 19633441
methyl 4-(4-fluorophenyl)-2-[[2-[[5-[(4-methoxyphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 19633441) has the molecular formula C27H25FN4O5S2 and a molecular weight of 568.65 g/mol. Its IUPAC name is methyl 4-(4-fluorophenyl)-2-[[2-[[5-[(4-methoxyphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-fluorophenyl)-2-[[2-[[5-[(4-methoxyphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19633441 |
| Molecular Formula | C27H25FN4O5S2 |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | methyl 4-(4-fluorophenyl)-2-[[2-[[5-[(4-methoxyphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | C=CCn1c(COc2ccc(OC)cc2)nnc1SCC(=O)Nc1scc(-c2ccc(F)cc2)c1C(=O)OC |
| InChI | InChI=1S/C27H25FN4O5S2/c1-4-13-32-22(14-37-20-11-9-19(35-2)10-12-20)30-31-27(32)39-16-23(33)29-25-24(26(34)36-3)21(15-38-25)17-5-7-18(28)8-6-17/h4-12,15H,1,13-14,16H2,2-3H3,(H,29,33) |
| InChIKey | HKXGETVGBJFXEM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|