C29H30N4O4S2 — CID 17269367
ethyl 2-[[2-[[5-[(4-ethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 17269367) has the molecular formula C29H30N4O4S2 and a molecular weight of 562.72 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-[(4-ethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-[(4-ethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 17269367 |
| Molecular Formula | C29H30N4O4S2 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | ethyl 2-[[2-[[5-[(4-ethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | C=CCn1c(COc2ccc(CC)cc2)nnc1SCC(=O)Nc1scc(-c2ccccc2)c1C(=O)OCC |
| InChI | InChI=1S/C29H30N4O4S2/c1-4-16-33-24(17-37-22-14-12-20(5-2)13-15-22)31-32-29(33)39-19-25(34)30-27-26(28(35)36-6-3)23(18-38-27)21-10-8-7-9-11-21/h4,7-15,18H,1,5-6,16-17,19H2,2-3H3,(H,30,34) |
| InChIKey | ARFPDIYBHDRQNS-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|