C26H23FN4O4S2 — CID 19733325
methyl 4-(4-fluorophenyl)-2-[[2-[[5-(phenoxymethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 19733325) has the molecular formula C26H23FN4O4S2 and a molecular weight of 538.63 g/mol. Its IUPAC name is methyl 4-(4-fluorophenyl)-2-[[2-[[5-(phenoxymethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-fluorophenyl)-2-[[2-[[5-(phenoxymethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19733325 |
| Molecular Formula | C26H23FN4O4S2 |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | methyl 4-(4-fluorophenyl)-2-[[2-[[5-(phenoxymethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | C=CCn1c(COc2ccccc2)nnc1SCC(=O)Nc1scc(-c2ccc(F)cc2)c1C(=O)OC |
| InChI | InChI=1S/C26H23FN4O4S2/c1-3-13-31-21(14-35-19-7-5-4-6-8-19)29-30-26(31)37-16-22(32)28-24-23(25(33)34-2)20(15-36-24)17-9-11-18(27)12-10-17/h3-12,15H,1,13-14,16H2,2H3,(H,28,32) |
| InChIKey | YQHBEOUZXZWFBT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|