C29H30N4O3S3 — CID 19722873
ethyl 2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 19722873) has the molecular formula C29H30N4O3S3 and a molecular weight of 578.79 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19722873 |
| Molecular Formula | C29H30N4O3S3 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.15 |
| IUPAC Name | ethyl 2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2scc(-c3ccccc3)c2C(=O)OCC)nnc1-c1csc2c1CCC(C)C2 |
| InChI | InChI=1S/C29H30N4O3S3/c1-4-13-33-26(22-16-37-23-14-18(3)11-12-20(22)23)31-32-29(33)39-17-24(34)30-27-25(28(35)36-5-2)21(15-38-27)19-9-7-6-8-10-19/h4,6-10,15-16,18H,1,5,11-14,17H2,2-3H3,(H,30,34) |
| InChIKey | FNHNGSJKGJGUMK-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|