C26H30N4O3S3 — CID 19722848
ethyl 2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 19722848) has the molecular formula C26H30N4O3S3 and a molecular weight of 542.75 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19722848 |
| Molecular Formula | C26H30N4O3S3 |
| Molecular Weight | 542.75 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | ethyl 2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C(=O)OCC)CCC3)nnc1-c1csc2c1CCC(C)C2 |
| InChI | InChI=1S/C26H30N4O3S3/c1-4-11-30-23(18-13-34-20-12-15(3)9-10-16(18)20)28-29-26(30)35-14-21(31)27-24-22(25(32)33-5-2)17-7-6-8-19(17)36-24/h4,13,15H,1,5-12,14H2,2-3H3,(H,27,31) |
| InChIKey | DUKORRPWZJBEOQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.75 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|