C23H26N4O3S3 — CID 19725549
ethyl 6-methyl-2-[[2-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19725549) has the molecular formula C23H26N4O3S3 and a molecular weight of 502.69 g/mol. Its IUPAC name is ethyl 6-methyl-2-[[2-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 6-methyl-2-[[2-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19725549 |
| Molecular Formula | C23H26N4O3S3 |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | ethyl 6-methyl-2-[[2-[(4-prop-2-enyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C(=O)OCC)CCC(C)C3)nnc1-c1cccs1 |
| InChI | InChI=1S/C23H26N4O3S3/c1-4-10-27-20(16-7-6-11-31-16)25-26-23(27)32-13-18(28)24-21-19(22(29)30-5-2)15-9-8-14(3)12-17(15)33-21/h4,6-7,11,14H,1,5,8-10,12-13H2,2-3H3,(H,24,28) |
| InChIKey | DLANFSYYUVXKKN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|