C25H27BrN4O3S2 — CID 19729470
ethyl 2-[[2-[[5-(4-bromophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19729470) has the molecular formula C25H27BrN4O3S2 and a molecular weight of 575.55 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-(4-bromophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-(4-bromophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19729470 |
| Molecular Formula | C25H27BrN4O3S2 |
| Molecular Weight | 575.55 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | ethyl 2-[[2-[[5-(4-bromophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C(=O)OCC)CCC(C)C3)nnc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H27BrN4O3S2/c1-4-12-30-22(16-7-9-17(26)10-8-16)28-29-25(30)34-14-20(31)27-23-21(24(32)33-5-2)18-11-6-15(3)13-19(18)35-23/h4,7-10,15H,1,5-6,11-14H2,2-3H3,(H,27,31) |
| InChIKey | HBNDCRUCZXXOEK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|