C25H30N4O3S2 — CID 19730196
ethyl 2-[[2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19730196) has the molecular formula C25H30N4O3S2 and a molecular weight of 498.67 g/mol. Its IUPAC name is ethyl 2-[[2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19730196 |
| Molecular Formula | C25H30N4O3S2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | ethyl 2-[[2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc(-c3ccc(C)cc3)n2CC)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C25H30N4O3S2/c1-5-29-22(17-10-7-15(3)8-11-17)27-28-25(29)33-14-20(30)26-23-21(24(31)32-6-2)18-12-9-16(4)13-19(18)34-23/h7-8,10-11,16H,5-6,9,12-14H2,1-4H3,(H,26,30) |
| InChIKey | VWTRGMSBBINOQP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |