C26H34N6O2S2 — CID 17268018
2-[[2-[[5-[4-(diethylamino)phenyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 17268018) has the molecular formula C26H34N6O2S2 and a molecular weight of 526.73 g/mol. Its IUPAC name is 2-[[2-[[5-[4-(diethylamino)phenyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[[5-[4-(diethylamino)phenyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 17268018 |
| Molecular Formula | C26H34N6O2S2 |
| Molecular Weight | 526.73 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 2-[[2-[[5-[4-(diethylamino)phenyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCN(CC)c1ccc(-c2nnc(SCC(=O)Nc3sc4c(c3C(N)=O)CCC(C)C4)n2CC)cc1 |
| InChI | InChI=1S/C26H34N6O2S2/c1-5-31(6-2)18-11-9-17(10-12-18)24-29-30-26(32(24)7-3)35-15-21(33)28-25-22(23(27)34)19-13-8-16(4)14-20(19)36-25/h9-12,16H,5-8,13-15H2,1-4H3,(H2,27,34)(H,28,33) |
| InChIKey | FZIGEDSRDDJBIM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.73 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |