C21H25N5O2S3 — CID 19717700
2-[[2-[[4-ethyl-5-(5-methylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 19717700) has the molecular formula C21H25N5O2S3 and a molecular weight of 475.67 g/mol. Its IUPAC name is 2-[[2-[[4-ethyl-5-(5-methylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[[4-ethyl-5-(5-methylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 19717700 |
| Molecular Formula | C21H25N5O2S3 |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 2-[[2-[[4-ethyl-5-(5-methylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCn1c(SCC(=O)Nc2sc3c(c2C(N)=O)CCC(C)C3)nnc1-c1csc(C)c1 |
| InChI | InChI=1S/C21H25N5O2S3/c1-4-26-19(13-8-12(3)29-9-13)24-25-21(26)30-10-16(27)23-20-17(18(22)28)14-6-5-11(2)7-15(14)31-20/h8-9,11H,4-7,10H2,1-3H3,(H2,22,28)(H,23,27) |
| InChIKey | TXMQBLMFZPEPIP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |