C26H33N5O3S2 — CID 19732619
2-[[2-[[5-(4-butoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 19732619) has the molecular formula C26H33N5O3S2 and a molecular weight of 527.72 g/mol. Its IUPAC name is 2-[[2-[[5-(4-butoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[[5-(4-butoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 19732619 |
| Molecular Formula | C26H33N5O3S2 |
| Molecular Weight | 527.72 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 2-[[2-[[5-(4-butoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCCCOc1ccc(-c2nnc(SCC(=O)Nc3sc4c(c3C(N)=O)CCC(C)C4)n2CC)cc1 |
| InChI | InChI=1S/C26H33N5O3S2/c1-4-6-13-34-18-10-8-17(9-11-18)24-29-30-26(31(24)5-2)35-15-21(32)28-25-22(23(27)33)19-12-7-16(3)14-20(19)36-25/h8-11,16H,4-7,12-15H2,1-3H3,(H2,27,33)(H,28,32) |
| InChIKey | GBLGYEVJRKUQCB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.72 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|