C27H35N5O3S2 — CID 19639231
2-[[2-[[4-ethyl-5-[1-(4-propan-2-ylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 19639231) has the molecular formula C27H35N5O3S2 and a molecular weight of 541.74 g/mol. Its IUPAC name is 2-[[2-[[4-ethyl-5-[1-(4-propan-2-ylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[[4-ethyl-5-[1-(4-propan-2-ylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 19639231 |
| Molecular Formula | C27H35N5O3S2 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | 2-[[2-[[4-ethyl-5-[1-(4-propan-2-ylphenoxy)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCn1c(SCC(=O)Nc2sc3c(c2C(N)=O)CCC(C)C3)nnc1C(C)Oc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C27H35N5O3S2/c1-6-32-25(17(5)35-19-10-8-18(9-11-19)15(2)3)30-31-27(32)36-14-22(33)29-26-23(24(28)34)20-12-7-16(4)13-21(20)37-26/h8-11,15-17H,6-7,12-14H2,1-5H3,(H2,28,34)(H,29,33) |
| InChIKey | GRVLRNDKQBWIFY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |