C26H30ClN5O3S2 — CID 19635321
2-[[2-[[5-[1-(2-chloro-5-methylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 19635321) has the molecular formula C26H30ClN5O3S2 and a molecular weight of 560.15 g/mol. Its IUPAC name is 2-[[2-[[5-[1-(2-chloro-5-methylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[[5-[1-(2-chloro-5-methylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 19635321 |
| Molecular Formula | C26H30ClN5O3S2 |
| Molecular Weight | 560.15 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | 2-[[2-[[5-[1-(2-chloro-5-methylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C(N)=O)CCC(C)C3)nnc1C(C)Oc1cc(C)ccc1Cl |
| InChI | InChI=1S/C26H30ClN5O3S2/c1-5-10-32-24(16(4)35-19-11-14(2)7-9-18(19)27)30-31-26(32)36-13-21(33)29-25-22(23(28)34)17-8-6-15(3)12-20(17)37-25/h5,7,9,11,15-16H,1,6,8,10,12-13H2,2-4H3,(H2,28,34)(H,29,33) |
| InChIKey | OMKZVFNVPXGDKI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.15 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|