C24H24Cl2N4O3S2 — CID 19729294
methyl 2-[[2-[[5-(3,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19729294) has the molecular formula C24H24Cl2N4O3S2 and a molecular weight of 551.52 g/mol. Its IUPAC name is methyl 2-[[2-[[5-(3,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-(3,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19729294 |
| Molecular Formula | C24H24Cl2N4O3S2 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 550.07 |
| IUPAC Name | methyl 2-[[2-[[5-(3,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C(=O)OC)CCC(C)C3)nnc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H24Cl2N4O3S2/c1-4-9-30-21(14-6-8-16(25)17(26)11-14)28-29-24(30)34-12-19(31)27-22-20(23(32)33-3)15-7-5-13(2)10-18(15)35-22/h4,6,8,11,13H,1,5,7,9-10,12H2,2-3H3,(H,27,31) |
| InChIKey | AVQFVYXAXYNMFZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|