C25H27ClN4O3S2 — CID 19728580
methyl 2-[[2-[[5-(3-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19728580) has the molecular formula C25H27ClN4O3S2 and a molecular weight of 531.10 g/mol. Its IUPAC name is methyl 2-[[2-[[5-(3-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-(3-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19728580 |
| Molecular Formula | C25H27ClN4O3S2 |
| Molecular Weight | 531.10 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | methyl 2-[[2-[[5-(3-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C(=O)OC)CCCCCC3)nnc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H27ClN4O3S2/c1-3-13-30-22(16-9-8-10-17(26)14-16)28-29-25(30)34-15-20(31)27-23-21(24(32)33-2)18-11-6-4-5-7-12-19(18)35-23/h3,8-10,14H,1,4-7,11-13,15H2,2H3,(H,27,31) |
| InChIKey | FBIVIHXTJLIWKV-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.10 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|