C27H32N4O3S3 — CID 19722275
methyl 2-[[2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19722275) has the molecular formula C27H32N4O3S3 and a molecular weight of 556.78 g/mol. Its IUPAC name is methyl 2-[[2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19722275 |
| Molecular Formula | C27H32N4O3S3 |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | methyl 2-[[2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C(=O)OC)CCCCCC3)nnc1-c1csc2c1CCCC2 |
| InChI | InChI=1S/C27H32N4O3S3/c1-3-14-31-24(19-15-35-20-12-9-8-10-17(19)20)29-30-27(31)36-16-22(32)28-25-23(26(33)34-2)18-11-6-4-5-7-13-21(18)37-25/h3,15H,1,4-14,16H2,2H3,(H,28,32) |
| InChIKey | ZLRVAOKAUJYZTO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|