C25H27N5OS3 — CID 19722272
N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19722272) has the molecular formula C25H27N5OS3 and a molecular weight of 509.73 g/mol. Its IUPAC name is N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19722272 |
| Molecular Formula | C25H27N5OS3 |
| Molecular Weight | 509.73 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2-[[4-prop-2-enyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCCCC3)nnc1-c1csc2c1CCCC2 |
| InChI | InChI=1S/C25H27N5OS3/c1-2-12-30-23(19-14-32-20-10-7-6-9-17(19)20)28-29-25(30)33-15-22(31)27-24-18(13-26)16-8-4-3-5-11-21(16)34-24/h2,14H,1,3-12,15H2,(H,27,31) |
| InChIKey | UUIHTHCXQJLSHX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.73 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|