C24H25ClN4O4S2 — CID 19731697
methyl 2-[[2-[[5-(5-chloro-2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19731697) has the molecular formula C24H25ClN4O4S2 and a molecular weight of 533.08 g/mol. Its IUPAC name is methyl 2-[[2-[[5-(5-chloro-2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-(5-chloro-2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19731697 |
| Molecular Formula | C24H25ClN4O4S2 |
| Molecular Weight | 533.08 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | methyl 2-[[2-[[5-(5-chloro-2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C(=O)OC)CCCC3)nnc1-c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C24H25ClN4O4S2/c1-4-11-29-21(16-12-14(25)9-10-17(16)32-2)27-28-24(29)34-13-19(30)26-22-20(23(31)33-3)15-7-5-6-8-18(15)35-22/h4,9-10,12H,1,5-8,11,13H2,2-3H3,(H,26,30) |
| InChIKey | RQJAEFOTJYTKFG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.08 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|