C23H24ClN5O3S — CID 17305797
2-[[2-[[5-[1-(2-chloro-5-methylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzamide (PubChem CID 17305797) has the molecular formula C23H24ClN5O3S and a molecular weight of 486.00 g/mol. Its IUPAC name is 2-[[2-[[5-[1-(2-chloro-5-methylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzamide.
| Compound Name | 2-[[2-[[5-[1-(2-chloro-5-methylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 17305797 |
| Molecular Formula | C23H24ClN5O3S |
| Molecular Weight | 486.00 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 2-[[2-[[5-[1-(2-chloro-5-methylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2C(N)=O)nnc1C(C)Oc1cc(C)ccc1Cl |
| InChI | InChI=1S/C23H24ClN5O3S/c1-4-11-29-22(15(3)32-19-12-14(2)9-10-17(19)24)27-28-23(29)33-13-20(30)26-18-8-6-5-7-16(18)21(25)31/h4-10,12,15H,1,11,13H2,2-3H3,(H2,25,31)(H,26,30) |
| InChIKey | YZEYOPOWMYYGBG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.00 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|