C24H27N5O3S — CID 17269203
2-[[2-[[5-[1-(2,3-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzamide (PubChem CID 17269203) has the molecular formula C24H27N5O3S and a molecular weight of 465.58 g/mol. Its IUPAC name is 2-[[2-[[5-[1-(2,3-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzamide.
| Compound Name | 2-[[2-[[5-[1-(2,3-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 17269203 |
| Molecular Formula | C24H27N5O3S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 2-[[2-[[5-[1-(2,3-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2C(N)=O)nnc1C(C)Oc1cccc(C)c1C |
| InChI | InChI=1S/C24H27N5O3S/c1-5-13-29-23(17(4)32-20-12-8-9-15(2)16(20)3)27-28-24(29)33-14-21(30)26-19-11-7-6-10-18(19)22(25)31/h5-12,17H,1,13-14H2,2-4H3,(H2,25,31)(H,26,30) |
| InChIKey | KBGFTQHVDAHDMU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|