C24H27F2N5O3S2 — CID 17305842
2-[[2-[[5-[1-(2,4-difluorophenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 17305842) has the molecular formula C24H27F2N5O3S2 and a molecular weight of 535.64 g/mol. Its IUPAC name is 2-[[2-[[5-[1-(2,4-difluorophenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[[5-[1-(2,4-difluorophenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 17305842 |
| Molecular Formula | C24H27F2N5O3S2 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | 2-[[2-[[5-[1-(2,4-difluorophenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCn1c(SCC(=O)Nc2sc3c(c2C(N)=O)CCC(C)C3)nnc1C(C)Oc1ccc(F)cc1F |
| InChI | InChI=1S/C24H27F2N5O3S2/c1-4-31-22(13(3)34-17-8-6-14(25)10-16(17)26)29-30-24(31)35-11-19(32)28-23-20(21(27)33)15-7-5-12(2)9-18(15)36-23/h6,8,10,12-13H,4-5,7,9,11H2,1-3H3,(H2,27,33)(H,28,32) |
| InChIKey | VNJRIBTWLJQZAV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |