C27H31F2N5O2S2 — CID 19635554
N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[1-(2,4-difluorophenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19635554) has the molecular formula C27H31F2N5O2S2 and a molecular weight of 559.71 g/mol. Its IUPAC name is N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[1-(2,4-difluorophenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[1-(2,4-difluorophenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19635554 |
| Molecular Formula | C27H31F2N5O2S2 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[1-(2,4-difluorophenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCC(C(C)(C)C)C3)nnc1C(C)Oc1ccc(F)cc1F |
| InChI | InChI=1S/C27H31F2N5O2S2/c1-6-34-24(15(2)36-21-10-8-17(28)12-20(21)29)32-33-26(34)37-14-23(35)31-25-19(13-30)18-9-7-16(27(3,4)5)11-22(18)38-25/h8,10,12,15-16H,6-7,9,11,14H2,1-5H3,(H,31,35) |
| InChIKey | UBLGLHKJHUOKNW-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |