C26H30ClN5O2S2 — CID 124541895
N-[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-(5-chloro-2-methoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 124541895) has the molecular formula C26H30ClN5O2S2 and a molecular weight of 544.15 g/mol. Its IUPAC name is N-[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-(5-chloro-2-methoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-(5-chloro-2-methoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 124541895 |
| Molecular Formula | C26H30ClN5O2S2 |
| Molecular Weight | 544.15 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | N-[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-(5-chloro-2-methoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2sc3c(c2C#N)CC[C@@H](C(C)(C)C)C3)nnc1-c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C26H30ClN5O2S2/c1-6-32-23(18-12-16(27)8-10-20(18)34-5)30-31-25(32)35-14-22(33)29-24-19(13-28)17-9-7-15(26(2,3)4)11-21(17)36-24/h8,10,12,15H,6-7,9,11,14H2,1-5H3,(H,29,33)/t15-/m1/s1 |
| InChIKey | GQXNEFLILUFXNK-OAHLLOKOSA-N |
| XLogP | 6.44 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.15 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |