C28H33ClN6O2S2 — CID 126361690
N-[(1S)-1-[5-[2-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]ethyl]-4-chlorobenzamide (PubChem CID 126361690) has the molecular formula C28H33ClN6O2S2 and a molecular weight of 585.20 g/mol. Its IUPAC name is N-[(1S)-1-[5-[2-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]ethyl]-4-chlorobenzamide.
| Compound Name | N-[(1S)-1-[5-[2-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]ethyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 126361690 |
| Molecular Formula | C28H33ClN6O2S2 |
| Molecular Weight | 585.20 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | N-[(1S)-1-[5-[2-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]ethyl]-4-chlorobenzamide |
| SMILES | CCn1c(SCC(=O)Nc2sc3c(c2C#N)CC[C@@H](C(C)(C)C)C3)nnc1[C@H](C)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H33ClN6O2S2/c1-6-35-24(16(2)31-25(37)17-7-10-19(29)11-8-17)33-34-27(35)38-15-23(36)32-26-21(14-30)20-12-9-18(28(3,4)5)13-22(20)39-26/h7-8,10-11,16,18H,6,9,12-13,15H2,1-5H3,(H,31,37)(H,32,36)/t16-,18+/m0/s1 |
| InChIKey | NAMUINCOXHXDJO-FUHWJXTLSA-N |
| XLogP | 6.26 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.20 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |