C25H35N5OS2 — CID 17303299
N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[(5-cyclohexyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 17303299) has the molecular formula C25H35N5OS2 and a molecular weight of 485.72 g/mol. Its IUPAC name is N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[(5-cyclohexyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[(5-cyclohexyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 17303299 |
| Molecular Formula | C25H35N5OS2 |
| Molecular Weight | 485.72 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[(5-cyclohexyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCC(C(C)(C)C)C3)nnc1C1CCCCC1 |
| InChI | InChI=1S/C25H35N5OS2/c1-5-30-22(16-9-7-6-8-10-16)28-29-24(30)32-15-21(31)27-23-19(14-26)18-12-11-17(25(2,3)4)13-20(18)33-23/h16-17H,5-13,15H2,1-4H3,(H,27,31) |
| InChIKey | DIPPFEPLGMCLAS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.72 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |