C31H41N5O2S2 — CID 19639507
N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19639507) has the molecular formula C31H41N5O2S2 and a molecular weight of 579.84 g/mol. Its IUPAC name is N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19639507 |
| Molecular Formula | C31H41N5O2S2 |
| Molecular Weight | 579.84 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCC(C(C)(C)C)C3)nnc1C(C)Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H41N5O2S2/c1-9-36-27(19(2)38-22-13-10-20(11-14-22)30(3,4)5)34-35-29(36)39-18-26(37)33-28-24(17-32)23-15-12-21(31(6,7)8)16-25(23)40-28/h10-11,13-14,19,21H,9,12,15-16,18H2,1-8H3,(H,33,37) |
| InChIKey | RNFNDKHFQNBZHZ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.84 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |