C33H43N5O2S2 — CID 19639698
2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide (PubChem CID 19639698) has the molecular formula C33H43N5O2S2 and a molecular weight of 605.87 g/mol. Its IUPAC name is 2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide.
| Compound Name | 2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide |
|---|---|
| PubChem CID | 19639698 |
| Molecular Formula | C33H43N5O2S2 |
| Molecular Weight | 605.87 g/mol |
| Exact Mass | 605.29 |
| IUPAC Name | 2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCC(C(C)(C)CC)C3)nnc1C(C)Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H43N5O2S2/c1-9-17-38-29(21(3)40-24-14-11-22(12-15-24)32(4,5)6)36-37-31(38)41-20-28(39)35-30-26(19-34)25-16-13-23(18-27(25)42-30)33(7,8)10-2/h9,11-12,14-15,21,23H,1,10,13,16-18,20H2,2-8H3,(H,35,39) |
| InChIKey | KFCVCGZUVNNOQB-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.87 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|