C29H34N6O2S2 — CID 126355765
N-[(1S)-1-[5-[2-[[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 126355765) has the molecular formula C29H34N6O2S2 and a molecular weight of 562.77 g/mol. Its IUPAC name is N-[(1S)-1-[5-[2-[[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | N-[(1S)-1-[5-[2-[[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 126355765 |
| Molecular Formula | C29H34N6O2S2 |
| Molecular Weight | 562.77 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | N-[(1S)-1-[5-[2-[[(6S)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C#N)CC[C@H](C(C)(C)C)C3)nnc1[C@H](C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H34N6O2S2/c1-6-14-35-25(18(2)31-26(37)19-10-8-7-9-11-19)33-34-28(35)38-17-24(36)32-27-22(16-30)21-13-12-20(29(3,4)5)15-23(21)39-27/h6-11,18,20H,1,12-15,17H2,2-5H3,(H,31,37)(H,32,36)/t18-,20-/m0/s1 |
| InChIKey | SFIWDNZMOXPSDH-ICSRJNTNSA-N |
| XLogP | 5.77 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.77 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|