C24H26BrN5O2S2 — CID 19724885
2-[[5-(5-bromofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide (PubChem CID 19724885) has the molecular formula C24H26BrN5O2S2 and a molecular weight of 560.54 g/mol. Its IUPAC name is 2-[[5-(5-bromofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide.
| Compound Name | 2-[[5-(5-bromofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 19724885 |
| Molecular Formula | C24H26BrN5O2S2 |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | 2-[[5-(5-bromofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCC(C(C)(C)C)C3)nnc1-c1ccc(Br)o1 |
| InChI | InChI=1S/C24H26BrN5O2S2/c1-5-10-30-21(17-8-9-19(25)32-17)28-29-23(30)33-13-20(31)27-22-16(12-26)15-7-6-14(24(2,3)4)11-18(15)34-22/h5,8-9,14H,1,6-7,10-11,13H2,2-4H3,(H,27,31) |
| InChIKey | HOGQPFBHELGVMX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|