C29H35N5O2S2 — CID 21166443
N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[(2,3-dimethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 21166443) has the molecular formula C29H35N5O2S2 and a molecular weight of 549.77 g/mol. Its IUPAC name is N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[(2,3-dimethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[(2,3-dimethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 21166443 |
| Molecular Formula | C29H35N5O2S2 |
| Molecular Weight | 549.77 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[(2,3-dimethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(COc2cccc(C)c2C)nnc1SCC(=O)Nc1sc2c(c1C#N)CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C29H35N5O2S2/c1-7-13-34-25(16-36-23-10-8-9-18(2)19(23)3)32-33-28(34)37-17-26(35)31-27-22(15-30)21-12-11-20(29(4,5)6)14-24(21)38-27/h7-10,20H,1,11-14,16-17H2,2-6H3,(H,31,35) |
| InChIKey | NGEKFJSJZCTZLG-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.77 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|