C27H33N5OS3 — CID 19721137
N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-(4,5-dimethylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19721137) has the molecular formula C27H33N5OS3 and a molecular weight of 539.80 g/mol. Its IUPAC name is N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-(4,5-dimethylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-(4,5-dimethylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19721137 |
| Molecular Formula | C27H33N5OS3 |
| Molecular Weight | 539.80 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[5-(4,5-dimethylthiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCC(C(C)(C)CC)C3)nnc1-c1csc(C)c1C |
| InChI | InChI=1S/C27H33N5OS3/c1-7-11-32-24(21-14-34-17(4)16(21)3)30-31-26(32)35-15-23(33)29-25-20(13-28)19-10-9-18(12-22(19)36-25)27(5,6)8-2/h7,14,18H,1,8-12,15H2,2-6H3,(H,29,33) |
| InChIKey | OYCJYKVKKYBTDM-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.80 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|