C27H30ClN5OS2 — CID 19728637
2-[[5-(3-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide (PubChem CID 19728637) has the molecular formula C27H30ClN5OS2 and a molecular weight of 540.16 g/mol. Its IUPAC name is 2-[[5-(3-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide.
| Compound Name | 2-[[5-(3-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide |
|---|---|
| PubChem CID | 19728637 |
| Molecular Formula | C27H30ClN5OS2 |
| Molecular Weight | 540.16 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-[[5-(3-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCC(C(C)(C)CC)C3)nnc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H30ClN5OS2/c1-5-12-33-24(17-8-7-9-19(28)13-17)31-32-26(33)35-16-23(34)30-25-21(15-29)20-11-10-18(14-22(20)36-25)27(3,4)6-2/h5,7-9,13,18H,1,6,10-12,14,16H2,2-4H3,(H,30,34) |
| InChIKey | BWTDFRAZRWNGMC-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.16 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|