C22H22ClN5OS2 — CID 19728469
2-[[5-(3-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide (PubChem CID 19728469) has the molecular formula C22H22ClN5OS2 and a molecular weight of 472.04 g/mol. Its IUPAC name is 2-[[5-(3-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide.
| Compound Name | 2-[[5-(3-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 19728469 |
| Molecular Formula | C22H22ClN5OS2 |
| Molecular Weight | 472.04 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 2-[[5-(3-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
| SMILES | CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCC(C)C3)nnc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H22ClN5OS2/c1-3-28-20(14-5-4-6-15(23)10-14)26-27-22(28)30-12-19(29)25-21-17(11-24)16-8-7-13(2)9-18(16)31-21/h4-6,10,13H,3,7-9,12H2,1-2H3,(H,25,29) |
| InChIKey | QFEKRYUYCZJREA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.04 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |