C24H27N5OS2 — CID 19730251
N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19730251) has the molecular formula C24H27N5OS2 and a molecular weight of 465.65 g/mol. Its IUPAC name is N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19730251 |
| Molecular Formula | C24H27N5OS2 |
| Molecular Weight | 465.65 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCC1CCc2c(sc(NC(=O)CSc3nnc(-c4ccc(C)cc4)n3CC)c2C#N)C1 |
| InChI | InChI=1S/C24H27N5OS2/c1-4-16-8-11-18-19(13-25)23(32-20(18)12-16)26-21(30)14-31-24-28-27-22(29(24)5-2)17-9-6-15(3)7-10-17/h6-7,9-10,16H,4-5,8,11-12,14H2,1-3H3,(H,26,30) |
| InChIKey | UOZDIXDIJBTMSE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |