C26H30ClN5O2S2 — CID 19641237
2-[[5-[1-(4-chloro-3-methylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide (PubChem CID 19641237) has the molecular formula C26H30ClN5O2S2 and a molecular weight of 544.15 g/mol. Its IUPAC name is 2-[[5-[1-(4-chloro-3-methylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide.
| Compound Name | 2-[[5-[1-(4-chloro-3-methylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 19641237 |
| Molecular Formula | C26H30ClN5O2S2 |
| Molecular Weight | 544.15 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 2-[[5-[1-(4-chloro-3-methylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
| SMILES | CCC1CCc2c(sc(NC(=O)CSc3nnc(C(C)Oc4ccc(Cl)c(C)c4)n3CC)c2C#N)C1 |
| InChI | InChI=1S/C26H30ClN5O2S2/c1-5-17-7-9-19-20(13-28)25(36-22(19)12-17)29-23(33)14-35-26-31-30-24(32(26)6-2)16(4)34-18-8-10-21(27)15(3)11-18/h8,10-11,16-17H,5-7,9,12,14H2,1-4H3,(H,29,33) |
| InChIKey | KQPKZOWMZOUSAC-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.15 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |