C24H26ClN5O2S2 — CID 17262568
2-[[5-[(4-chloro-3-methylphenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide (PubChem CID 17262568) has the molecular formula C24H26ClN5O2S2 and a molecular weight of 516.09 g/mol. Its IUPAC name is 2-[[5-[(4-chloro-3-methylphenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide.
| Compound Name | 2-[[5-[(4-chloro-3-methylphenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 17262568 |
| Molecular Formula | C24H26ClN5O2S2 |
| Molecular Weight | 516.09 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | 2-[[5-[(4-chloro-3-methylphenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
| SMILES | CCn1c(COc2ccc(Cl)c(C)c2)nnc1SCC(=O)Nc1sc2c(c1C#N)CCC(C)C2 |
| InChI | InChI=1S/C24H26ClN5O2S2/c1-4-30-21(12-32-16-6-8-19(25)15(3)10-16)28-29-24(30)33-13-22(31)27-23-18(11-26)17-7-5-14(2)9-20(17)34-23/h6,8,10,14H,4-5,7,9,12-13H2,1-3H3,(H,27,31) |
| InChIKey | FYHKUHZNNMUVDF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.09 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |