C24H27N5O2S2 — CID 21165548
N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[(3,4-dimethylphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 21165548) has the molecular formula C24H27N5O2S2 and a molecular weight of 481.65 g/mol. Its IUPAC name is N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[(3,4-dimethylphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[(3,4-dimethylphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 21165548 |
| Molecular Formula | C24H27N5O2S2 |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[(3,4-dimethylphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(OCc2nnc(SCC(=O)Nc3sc4c(c3C#N)CCC(C)C4)n2C)cc1C |
| InChI | InChI=1S/C24H27N5O2S2/c1-14-5-8-18-19(11-25)23(33-20(18)9-14)26-22(30)13-32-24-28-27-21(29(24)4)12-31-17-7-6-15(2)16(3)10-17/h6-7,10,14H,5,8-9,12-13H2,1-4H3,(H,26,30) |
| InChIKey | IRFJXAAFYHZWHY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |