C27H31N5O2S2 — CID 17304622
N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-[[5-[(3,4-dimethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17304622) has the molecular formula C27H31N5O2S2 and a molecular weight of 521.71 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-[[5-[(3,4-dimethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-[[5-[(3,4-dimethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17304622 |
| Molecular Formula | C27H31N5O2S2 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-2-[[5-[(3,4-dimethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(COc2ccc(C)c(C)c2)nnc1SCC(=O)Nc1sc2c(c1C#N)CCCCCC2 |
| InChI | InChI=1S/C27H31N5O2S2/c1-4-13-32-24(16-34-20-12-11-18(2)19(3)14-20)30-31-27(32)35-17-25(33)29-26-22(15-28)21-9-7-5-6-8-10-23(21)36-26/h4,11-12,14H,1,5-10,13,16-17H2,2-3H3,(H,29,33) |
| InChIKey | MFRIMAKKRLFXCJ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|