C26H28ClFN4O4S2 — CID 21164808
methyl 2-[[2-[[5-[(3-chloro-4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 21164808) has the molecular formula C26H28ClFN4O4S2 and a molecular weight of 579.12 g/mol. Its IUPAC name is methyl 2-[[2-[[5-[(3-chloro-4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-[(3-chloro-4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 21164808 |
| Molecular Formula | C26H28ClFN4O4S2 |
| Molecular Weight | 579.12 g/mol |
| Exact Mass | 578.12 |
| IUPAC Name | methyl 2-[[2-[[5-[(3-chloro-4-fluorophenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | C=CCn1c(COc2ccc(F)c(Cl)c2)nnc1SCC(=O)Nc1sc2c(c1C(=O)OC)CCCCCC2 |
| InChI | InChI=1S/C26H28ClFN4O4S2/c1-3-12-32-21(14-36-16-10-11-19(28)18(27)13-16)30-31-26(32)37-15-22(33)29-24-23(25(34)35-2)17-8-6-4-5-7-9-20(17)38-24/h3,10-11,13H,1,4-9,12,14-15H2,2H3,(H,29,33) |
| InChIKey | ZRNYFVLZAYCUFX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.12 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|