C26H30N4O4S2 — CID 19733311
propan-2-yl 2-[[2-[[5-(phenoxymethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19733311) has the molecular formula C26H30N4O4S2 and a molecular weight of 526.68 g/mol. Its IUPAC name is propan-2-yl 2-[[2-[[5-(phenoxymethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[[2-[[5-(phenoxymethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19733311 |
| Molecular Formula | C26H30N4O4S2 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | propan-2-yl 2-[[2-[[5-(phenoxymethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCn1c(COc2ccccc2)nnc1SCC(=O)Nc1sc2c(c1C(=O)OC(C)C)CCCC2 |
| InChI | InChI=1S/C26H30N4O4S2/c1-4-14-30-21(15-33-18-10-6-5-7-11-18)28-29-26(30)35-16-22(31)27-24-23(25(32)34-17(2)3)19-12-8-9-13-20(19)36-24/h4-7,10-11,17H,1,8-9,12-16H2,2-3H3,(H,27,31) |
| InChIKey | MMXGWVLHRPWGMD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|