C21H20ClN5OS2 — CID 3923962
2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide (PubChem CID 3923962) has the molecular formula C21H20ClN5OS2 and a molecular weight of 458.01 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 3923962 |
| Molecular Formula | C21H20ClN5OS2 |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
| SMILES | CC1CCc2c(sc(NC(=O)CSc3nnc(-c4ccc(Cl)cc4)n3C)c2C#N)C1 |
| InChI | InChI=1S/C21H20ClN5OS2/c1-12-3-8-15-16(10-23)20(30-17(15)9-12)24-18(28)11-29-21-26-25-19(27(21)2)13-4-6-14(22)7-5-13/h4-7,12H,3,8-9,11H2,1-2H3,(H,24,28) |
| InChIKey | QSTZTKINDZYZGB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |