C20H17ClN4OS4 — CID 2450458
2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide (PubChem CID 2450458) has the molecular formula C20H17ClN4OS4 and a molecular weight of 493.10 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide |
|---|---|
| PubChem CID | 2450458 |
| Molecular Formula | C20H17ClN4OS4 |
| Molecular Weight | 493.10 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide |
| SMILES | C[C@H]1CCc2c(sc(NC(=O)CSc3nn(-c4ccc(Cl)cc4)c(=S)s3)c2C#N)C1 |
| InChI | InChI=1S/C20H17ClN4OS4/c1-11-2-7-14-15(9-22)18(29-16(14)8-11)23-17(26)10-28-19-24-25(20(27)30-19)13-5-3-12(21)4-6-13/h3-6,11H,2,7-8,10H2,1H3,(H,23,26)/t11-/m0/s1 |
| InChIKey | HSYPNYNIYYRLLF-NSHDSACASA-N |
| XLogP | 6.11 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.10 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|