C16H16F3N5OS2 — CID 2511324
N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 2511324) has the molecular formula C16H16F3N5OS2 and a molecular weight of 415.47 g/mol. Its IUPAC name is N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2511324 |
| Molecular Formula | C16H16F3N5OS2 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C[C@@H]1CCc2c(sc(NC(=O)CSc3nnc(C(F)(F)F)n3C)c2C#N)C1 |
| InChI | InChI=1S/C16H16F3N5OS2/c1-8-3-4-9-10(6-20)13(27-11(9)5-8)21-12(25)7-26-15-23-22-14(24(15)2)16(17,18)19/h8H,3-5,7H2,1-2H3,(H,21,25)/t8-/m1/s1 |
| InChIKey | VKTJUOSESSTLNM-MRVPVSSYSA-N |
| XLogP | 3.62 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |