C19H20N6OS2 — CID 2462417
N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetamide (PubChem CID 2462417) has the molecular formula C19H20N6OS2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetamide.
| Compound Name | N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2462417 |
| Molecular Formula | C19H20N6OS2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetamide |
| SMILES | Cc1cc(C)n2c(SCC(=O)Nc3sc4c(c3C#N)CC[C@@H](C)C4)nnc2n1 |
| InChI | InChI=1S/C19H20N6OS2/c1-10-4-5-13-14(8-20)17(28-15(13)6-10)22-16(26)9-27-19-24-23-18-21-11(2)7-12(3)25(18)19/h7,10H,4-6,9H2,1-3H3,(H,22,26)/t10-/m1/s1 |
| InChIKey | LCBJHIHRDLUFSD-SNVBAGLBSA-N |
| XLogP | 3.53 |
| TPSA | 95.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |