C22H24N6O3S2 — CID 4575698
2-[[4-amino-5-(3,4-dimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide (PubChem CID 4575698) has the molecular formula C22H24N6O3S2 and a molecular weight of 484.61 g/mol. Its IUPAC name is 2-[[4-amino-5-(3,4-dimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide.
| Compound Name | 2-[[4-amino-5-(3,4-dimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 4575698 |
| Molecular Formula | C22H24N6O3S2 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-[[4-amino-5-(3,4-dimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
| SMILES | COc1ccc(-c2nnc(SCC(=O)Nc3sc4c(c3C#N)CCC(C)C4)n2N)cc1OC |
| InChI | InChI=1S/C22H24N6O3S2/c1-12-4-6-14-15(10-23)21(33-18(14)8-12)25-19(29)11-32-22-27-26-20(28(22)24)13-5-7-16(30-2)17(9-13)31-3/h5,7,9,12H,4,6,8,11,24H2,1-3H3,(H,25,29) |
| InChIKey | VNLOVZIYDPOLGW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |