C25H30N4O5S2 — CID 19730898
ethyl 2-[[2-[[5-(3,4-dimethoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19730898) has the molecular formula C25H30N4O5S2 and a molecular weight of 530.67 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-(3,4-dimethoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-(3,4-dimethoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19730898 |
| Molecular Formula | C25H30N4O5S2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | ethyl 2-[[2-[[5-(3,4-dimethoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc(-c3ccc(OC)c(OC)c3)n2C)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C25H30N4O5S2/c1-6-34-24(31)21-16-9-7-14(2)11-19(16)36-23(21)26-20(30)13-35-25-28-27-22(29(25)3)15-8-10-17(32-4)18(12-15)33-5/h8,10,12,14H,6-7,9,11,13H2,1-5H3,(H,26,30) |
| InChIKey | QCDZLXPPPZVBHW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |