C17H20N6OS2 — CID 31193190
2-[(4-amino-5-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide (PubChem CID 31193190) has the molecular formula C17H20N6OS2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 2-[(4-amino-5-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide.
| Compound Name | 2-[(4-amino-5-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide |
|---|---|
| PubChem CID | 31193190 |
| Molecular Formula | C17H20N6OS2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-[(4-amino-5-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide |
| SMILES | C[C@H]1CCc2c(sc(NC(=O)CSc3nnc(C4CC4)n3N)c2C#N)C1 |
| InChI | InChI=1S/C17H20N6OS2/c1-9-2-5-11-12(7-18)16(26-13(11)6-9)20-14(24)8-25-17-22-21-15(23(17)19)10-3-4-10/h9-10H,2-6,8,19H2,1H3,(H,20,24)/t9-/m0/s1 |
| InChIKey | FRASFZUGNZFTNJ-VIFPVBQESA-N |
| XLogP | 2.66 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |