C26H31N5O2S2 — CID 19636924
N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[1-(3,4-dimethylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19636924) has the molecular formula C26H31N5O2S2 and a molecular weight of 509.70 g/mol. Its IUPAC name is N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[1-(3,4-dimethylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[1-(3,4-dimethylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19636924 |
| Molecular Formula | C26H31N5O2S2 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[[5-[1-(3,4-dimethylphenoxy)ethyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCC(C)C3)nnc1C(C)Oc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C26H31N5O2S2/c1-6-31-24(18(5)33-19-9-8-16(3)17(4)12-19)29-30-26(31)34-14-23(32)28-25-21(13-27)20-10-7-15(2)11-22(20)35-25/h8-9,12,15,18H,6-7,10-11,14H2,1-5H3,(H,28,32) |
| InChIKey | GHNOLLXKSCJVKQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |