C26H30FN5OS2 — CID 19729691
N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[4-ethyl-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19729691) has the molecular formula C26H30FN5OS2 and a molecular weight of 511.69 g/mol. Its IUPAC name is N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[4-ethyl-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[4-ethyl-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19729691 |
| Molecular Formula | C26H30FN5OS2 |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | N-[3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-[[4-ethyl-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2sc3c(c2C#N)CCC(C(C)(C)CC)C3)nnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H30FN5OS2/c1-5-26(3,4)17-9-12-19-20(14-28)24(35-21(19)13-17)29-22(33)15-34-25-31-30-23(32(25)6-2)16-7-10-18(27)11-8-16/h7-8,10-11,17H,5-6,9,12-13,15H2,1-4H3,(H,29,33) |
| InChIKey | HFHFAKFVFCMJHQ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |